Products 2137490-19-6
CAS 2137490-19-6 appears in our catalog under these names: Fmoc–Ser–OH–15N, Fmoc-Ser-OH-15N, 98%, 98%, Fmoc-Ser-OH-15N, 98.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 5 mg, 10 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-hydroxypropanoic acid (CAS 2137490-19-6) is a chemical compound with the molecular formula C18H17NO5 and a molecular weight of 328.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-hydroxypropanoic acid. InChIKey: JZTKZVJMSCONAK-BTEQYEEISA-N.
| Molecular formula | C18H17NO5 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-hydroxypropanoic acid |
| InChIKey | JZTKZVJMSCONAK-BTEQYEEISA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)[15NH][C@@H](CO)C(=O)O |
Computed by PubChem (NCBI)