CAS 135355-96-3 appears in our catalog under these names: Fumaric Acid tert-Butyl Ester (>90%), >95% (HPLC), Fumaric acid tert–butyl ester, (E)-4-(tert-Butoxy)-4-oxobut-2-enoic acid, 97%, 97%, Fumaric acid mono-tert-butyl ester, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 500mg, 5g, 10g, 1g, 250mg, 100mg, 50g.
(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoic acid (CAS 135355-96-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: (E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoic acid. InChIKey: BAXKSCVINAKVNE-SNAWJCMRSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | (E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoic acid |
| InChIKey | BAXKSCVINAKVNE-SNAWJCMRSA-N |
| SMILES | CC(C)(C)OC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)