CAS 1193523-95-3 is the registry number for (S)-7-Hydroxy-1,4-dioxaspiro[4.5]decan-8-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(7S)-7-hydroxy-1,4-dioxaspiro[4.5]decan-8-one (CAS 1193523-95-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: (7S)-7-hydroxy-1,4-dioxaspiro[4.5]decan-8-one. InChIKey: OVTNSAGYNLKXNZ-ZETCQYMHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | (7S)-7-hydroxy-1,4-dioxaspiro[4.5]decan-8-one |
| InChIKey | OVTNSAGYNLKXNZ-ZETCQYMHSA-N |
| SMILES | C1CC2(C[C@@H](C1=O)O)OCCO2 |
Computed by PubChem (NCBI)