CAS 21963-41-7 appears in our catalog under these names: (1S,2S)-1,2-Cyclohexanedicarboxylic acid, 95%, Perospirone Impurity 34, (1S,2S)–Cyclohexane–1,2–dicarboxylicacid, (1S,2S)-Cyclohexane-1,2-dicarboxylic acid, 98+% , (1S,2S)-1,2-Cyclohexanedicarboxylic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 100g, 1g, on request, 1kg, 10g, 500g.
Trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid (CAS 21963-41-7) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-WDSKDSINSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-WDSKDSINSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)