CAS 96382-85-3 appears in our catalog under these names: cis-3-Carbomethoxycyclopentane-1-carboxylic acid, Cis-3-carbomethoxycyclopentane-1-carboxylic acid, 95%, (1R,3S)–rel–3–(Methoxycarbonyl)cyclopentanecarboxylic acid, (1R,3S)-rel-3-(Methoxycarbonyl)cyclopentanecarboxylic acid, 97%, (1R,3S)-rel-3-(Methoxycarbonyl)cyclopentanecarboxylic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 0,5g, 250mg, 1g, 10g, 100mg, 500mg.
Cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 96382-85-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: FVUHGTQDOMGZOT-NTSWFWBYSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid |
| InChIKey | FVUHGTQDOMGZOT-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)