CAS 610-09-3 appears in our catalog under these names: Cis-1,2-cyclohexanedicarboxylic acid, 98%, Mitiglinide Impurity 18 (cis-1,2-cyclohexanedicarboxylic acid), cis–Cyclohexane–1,2–dicarboxylic acid, cis-1,2-Cyclohexanedicarboxylic Acid, >98.0%(GC)(T), cis-Cyclohexane-1,2-dicarboxylic acid 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Ambeed. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, on request, 10g, 1000g.
Cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid (CAS 610-09-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-OLQVQODUSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-OLQVQODUSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)