CAS 2305-30-8 appears in our catalog under these names: Trans-cyclohexane-1,3-dicarboxylic acid, 95%, trans-Cyclohexane-1,3-dicarboxylic acid, 95%, 95%, trans-Cyclohexane-1,3-dicarboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
Trans-(1R,3R)-cyclohexane-1,3-dicarboxylic acid (CAS 2305-30-8) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,3R)-cyclohexane-1,3-dicarboxylic acid. InChIKey: XBZSBBLNHFMTEB-PHDIDXHHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,3R)-cyclohexane-1,3-dicarboxylic acid |
| InChIKey | XBZSBBLNHFMTEB-PHDIDXHHSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)