CAS 96443-42-4 appears in our catalog under these names: (1S,3R)-3-carbomethoxy cyclopentane-1-carboxylic acid, 97%, (1R,3S)-1,3-Cyclopentanedicarboxylic Acid 1-Methyl Ester, (1S,3R)-3-(Methoxycarbonyl)cyclopentanecarboxylic acid, 97%, (1S,3R)-cis-3-(Methoxycarbonyl)cyclopentane-1-carboxylic aci, (1S,3R)-3-(Methoxycarbonyl)cyclopentanecarboxylic acid 95%. Offered by: Combi-blocks, TRC, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g, 0,25g, 250g, 100g.
Cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 96443-42-4) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: FVUHGTQDOMGZOT-NTSWFWBYSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1S,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid |
| InChIKey | FVUHGTQDOMGZOT-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)