CAS 111138-44-4 appears in our catalog under these names: Trans-2-carbomethoxycyclopentane-1-carboxylic acid, 95%, Trans-2-carbomethoxycyclopentane-1-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
Trans-(1R,2R)-2-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 111138-44-4) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,2R)-2-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: KYGFHAUBFNTXFK-PHDIDXHHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-methoxycarbonylcyclopentane-1-carboxylic acid |
| InChIKey | KYGFHAUBFNTXFK-PHDIDXHHSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)