H-ALA-GLY-OME HCL, 98%, 98%
cas: 23404-09-3 — see every product listed under this CAS number, including other names
H-ALA-GLY-OME HCL, 98%, 98% (CAS 23404-09-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2MQ-100mg |
| cas | 23404-09-3 |
| size | 100mg |
| availability | 1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride (CAS 23404-09-3) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride. InChIKey: YPQGKQWQCHPXLB-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride |
| InChIKey | YPQGKQWQCHPXLB-WCCKRBBISA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)OC)N.Cl |
Computed by PubChem (NCBI)