cas: 23404-09-3 — see every product listed under this CAS number, including other names
Methyl L-alanylglycinate hydrochloride, 98% (CAS 23404-09-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F772313-5G |
| cas | 23404-09-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 534.20 Pln | |
| Fluorochem | 1g | 174.96 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride (CAS 23404-09-3) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride. InChIKey: YPQGKQWQCHPXLB-WCCKRBBISA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl 2-[[(2S)-2-aminopropanoyl]amino]acetate;hydrochloride |
| InChIKey | YPQGKQWQCHPXLB-WCCKRBBISA-N |
| SMILES | C[C@@H](C(=O)NCC(=O)OC)N.Cl |
Computed by PubChem (NCBI)