H-Ala-OBzl·HCl 98%
cas: 5557-83-5 — see every product listed under this CAS number, including other names
H-Ala-OBzl·HCl 98% (CAS 5557-83-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A169435-5g |
| cas | 5557-83-5 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 320.31 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 848.75 Pln | |
| Ambeed | 1000g | 1399.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A169435 |
Benzyl (2S)-2-aminopropanoate;hydrochloride (CAS 5557-83-5) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl (2S)-2-aminopropanoate;hydrochloride. InChIKey: RLMHWGDKMJIEHH-QRPNPIFTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | RLMHWGDKMJIEHH-QRPNPIFTSA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-Alanine benzyl ester hydrochloride, H-Ala-OBzl.HCl, L-Alanine benzyl ester HCl, H-ALA-OBZL HCL, (S)-Benzyl 2-aminopropanoate Hydrochloride, benzyl (2S)-2-aminopropanoate hydrochloride, benzyl (2S)-2-aminopropanoate;hydrochloride, alanine benzyl ester hydrochloride salt, H-Ala-OBzl hydrochloride, H-Ala-OBzlHCl