cas: 5557-83-5 — see every product listed under this CAS number, including other names
L-Alanine Benzyl Ester Hydrochloride, >98.0%(HPLC)(T) (CAS 5557-83-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2771-5G |
| cas | 5557-83-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 108.51 Pln | |
| TCI | 25g | 433.05 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Benzyl (2S)-2-aminopropanoate;hydrochloride (CAS 5557-83-5) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl (2S)-2-aminopropanoate;hydrochloride. InChIKey: RLMHWGDKMJIEHH-QRPNPIFTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | RLMHWGDKMJIEHH-QRPNPIFTSA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)