cas: 34404-37-0 — see every product listed under this CAS number, including other names
H-D-Ala-OBzl HCl 95% (CAS 34404-37-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1085145-5g |
| cas | 34404-37-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 420.44 Pln | |
| Ambeed | 10g | 553.94 Pln | |
| Ambeed | 25g | 865.44 Pln | |
| Ambeed | 100g | 2884.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1085145 |
Benzyl (2R)-2-aminopropanoate;hydrochloride (CAS 34404-37-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl (2R)-2-aminopropanoate;hydrochloride. InChIKey: RLMHWGDKMJIEHH-DDWIOCJRSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl (2R)-2-aminopropanoate;hydrochloride |
| InChIKey | RLMHWGDKMJIEHH-DDWIOCJRSA-N |
| SMILES | C[C@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)