CAS 2578-33-8 appears in our catalog under these names: H–D–Glu(OBzl)–OH, H-D-Glu(OBzl)-OH, D-Glutamic Acid 5-Benzyl Ester, 98%, 98%, H-D-Glu(OBzl)-OH, 99.93%, H-D-Glu(OBzl)-OH, 97%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 500g, 25g, 1g, 5g, 10g, 25 g, 500 g.
(2R)-2-amino-5-oxo-5-phenylmethoxypentanoic acid (CAS 2578-33-8) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2R)-2-amino-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: BGGHCRNCRWQABU-SNVBAGLBSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2R)-2-amino-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | BGGHCRNCRWQABU-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)