Products 29456-09-5
CAS 29456-09-5 appears in our catalog under these names: 2-Amino-5-(benzyloxy)-5-oxopentanoic acid, 95%, 2-AMINO-5-(BENZYLOXY)-5-OXOPENTANOIC ACID, 98%, 98%, H-DL-Glu(OBzl)-OH 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-amino-5-oxo-5-phenylmethoxypentanoic acid (CAS 29456-09-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-amino-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: BGGHCRNCRWQABU-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-amino-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | BGGHCRNCRWQABU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
POLY-GAMMA-BENZYL L-GLUTAMATE, .gamma.-Benzyl L-glutamate, L-Glutamic acid ?-benzyl ester, Glutamic acid .gamma.-benzyl ester, Glutamic acid, 5-benzyl ester, L-, 2-amino-5-oxo-5-phenylmethoxypentanoic acid, (2S)-2-amino-5-benzyloxy-5-oxo-pentanoic acid, 2-amino-5-benzyloxy-5-oxo-pentanoic acid, Glutamic acid, 5-(phenylmethyl) ester, Poly-IU-benzyl-L-glutamate