Products 25014-27-1
CAS 25014-27-1 appears in our catalog under these names: Poly-γ-benzyl-L-glutamate (MW 150000-350000), γ-Benzyl L-glutamate homopolymer, mol wt 150,000-350,000, Poly-gamma-benzyl-L-glutamate 150,000-35, Poly-gamma-benzyl-L-glutamate 70,000-150. Offered by: MedChemExpress, Chemat, Sigma-Aldrich. Available pack sizes: Get quote, 1g.
2-amino-5-oxo-5-phenylmethoxypentanoic acid (CAS 25014-27-1) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-amino-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: BGGHCRNCRWQABU-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-amino-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | BGGHCRNCRWQABU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCC(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
POLY-GAMMA-BENZYL L-GLUTAMATE, .gamma.-Benzyl L-glutamate, L-Glutamic acid ?-benzyl ester, Glutamic acid .gamma.-benzyl ester, Glutamic acid, 5-benzyl ester, L-, 2-amino-5-oxo-5-phenylmethoxypentanoic acid, (2S)-2-amino-5-benzyloxy-5-oxo-pentanoic acid, 2-amino-5-benzyloxy-5-oxo-pentanoic acid, Glutamic acid, 5-(phenylmethyl) ester, Poly-IU-benzyl-L-glutamate