cas: 45125-00-6 — see every product listed under this CAS number, including other names
H-D-Glu(OtBu)-OH, 97%, 97% (CAS 45125-00-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PAC-1g |
| cas | 45125-00-6 |
| size | 1g |
| availability | 350g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 309.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 45125-00-6) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: OIOAKXPMBIZAHL-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | OIOAKXPMBIZAHL-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)