CAS 2419-56-9 appears in our catalog under these names: H–Glu(OtBu)–OH, H-L-Glu(OtBu)-OH*H2O, L-Glutamic acid 5-tert-butyl ester, 98% , 5-tert-Butyl L-Glutamate, >98.0%(T), L-Glutamic acid 5-tert-butyl ester. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 100g, 25g, 5g, 1g, 0,025kg, 0,05kg, 0,1kg, 0,5kg.
(2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 2419-56-9) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: OIOAKXPMBIZAHL-LURJTMIESA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | OIOAKXPMBIZAHL-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)