cas: 37763-23-8 — see every product listed under this CAS number, including other names
H-D-Phg(4-OH)-OMe 97% (CAS 37763-23-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A347614-25g |
| cas | 37763-23-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 131.19 Pln | |
| Ambeed | 100g | 292.50 Pln | |
| Ambeed | 500g | 1154.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A347614 |
Methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate (CAS 37763-23-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate. InChIKey: SZBDOFWNZVHVGR-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate |
| InChIKey | SZBDOFWNZVHVGR-MRVPVSSYSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)