cas: 19883-41-1 — see every product listed under this CAS number, including other names
H-D-Phg-OMe.HCl, 98.0% (CAS 19883-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W014824-100 g |
| cas | 19883-41-1 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 333.62 Pln | |
| MedChemExpress | 500 g | 519.38 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
Methyl (2R)-2-amino-2-phenylacetate;hydrochloride (CAS 19883-41-1) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl (2R)-2-amino-2-phenylacetate;hydrochloride. InChIKey: DTHMTBUWTGVEFG-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-phenylacetate;hydrochloride |
| InChIKey | DTHMTBUWTGVEFG-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)