Products 13226-98-7
CAS 13226-98-7 appears in our catalog under these names: L-Phenylglycine methyl ester hydrochloride, 98%, 98%, (s)–2–phenylglycine methyl ester hydrochloride. Offered by: Chemat, GLPBio. Available pack sizes: 5g, 25g, 100g, 500g, 250mg.
Methyl (2S)-2-amino-2-phenylacetate;hydrochloride (CAS 13226-98-7) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl (2S)-2-amino-2-phenylacetate;hydrochloride. InChIKey: DTHMTBUWTGVEFG-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-phenylacetate;hydrochloride |
| InChIKey | DTHMTBUWTGVEFG-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-(+)-2-Phenylglycine methyl ester hydrochloride, L-Phenylglycine methyl ester hydrochloride, (S)-Methyl 2-amino-2-phenylacetate hydrochloride, H-PHG-OME HCL, H-Phg-OMe.HCl, H-Phg-Ome Hydrochloride, Methyl (S)-2-amino-2-phenylacetate hydrochloride, methyl (2S)-2-amino-2-phenylacetate;hydrochloride, (R)-(-)-2-Phenylglycinemethyl ester hydrochloride, methyl (2S)-amino(phenyl)acetate hydrochloride