CAS 19883-41-1 appears in our catalog under these names: Cephalexin Impurity 1, Cephalexin Impurity 1 HCl (D-Phenylglycine Methyl Ester HCl), (R)-(-)-2-Phenylglycine Methyl Ester Hydrochloride, Methyl (2R)-2-Amino-2-phenylacetate Hydrochloride, H–D–Phg–OMe?HCl. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Iris Biotech. Available pack sizes: on request, 1g, 500mg, 5g, 25mg, 500g, 25g, 100g.
Methyl (2R)-2-amino-2-phenylacetate;hydrochloride (CAS 19883-41-1) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl (2R)-2-amino-2-phenylacetate;hydrochloride. InChIKey: DTHMTBUWTGVEFG-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-phenylacetate;hydrochloride |
| InChIKey | DTHMTBUWTGVEFG-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)