cas: 97611-60-4 — see every product listed under this CAS number, including other names
H-DL-Gly(1-Naphthyl)-OH 96% (CAS 97611-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A353565-100mg |
| cas | 97611-60-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2066.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A353565 |
2-amino-2-naphthalen-1-ylacetic acid (CAS 97611-60-4) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-amino-2-naphthalen-1-ylacetic acid. InChIKey: SCDZHZMVNQDLCM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-amino-2-naphthalen-1-ylacetic acid |
| InChIKey | SCDZHZMVNQDLCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C(=O)O)N |
Computed by PubChem (NCBI)