cas: 119483-47-5 — see every product listed under this CAS number, including other names
H-Nva-Otbu.Hcl, 97%, 97% (CAS 119483-47-5) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IUY-50g |
| cas | 119483-47-5 |
| size | 50g |
| availability | 213g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 266.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 448.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-aminopentanoate;hydrochloride (CAS 119483-47-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2S)-2-aminopentanoate;hydrochloride. InChIKey: YQHANSSYWITJHA-FJXQXJEOSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2S)-2-aminopentanoate;hydrochloride |
| InChIKey | YQHANSSYWITJHA-FJXQXJEOSA-N |
| SMILES | CCC[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)