cas: 119483-47-5 — see every product listed under this CAS number, including other names
L-Norvaline t-butyl ester hydrochloride, 97% (CAS 119483-47-5) is a chemical reagent available from Chemat. Available pack sizes: 2.5g, 5g, 10g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222033-2.5G |
| cas | 119483-47-5 |
| size | 2.5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 2.5g | 143.72 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 299.91 Pln | |
| Fluorochem | 100g | 784.12 Pln | |
| Fluorochem | 250g | 1502.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2S)-2-aminopentanoate;hydrochloride (CAS 119483-47-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2S)-2-aminopentanoate;hydrochloride. InChIKey: YQHANSSYWITJHA-FJXQXJEOSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2S)-2-aminopentanoate;hydrochloride |
| InChIKey | YQHANSSYWITJHA-FJXQXJEOSA-N |
| SMILES | CCC[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)