cas: 5022-65-1 — see every product listed under this CAS number, including other names
H-Trp-NH2.HCl 95% (CAS 5022-65-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A461018-250mg |
| cas | 5022-65-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 259.12 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A461018 |
(2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride (CAS 5022-65-1) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride. InChIKey: WOBDANBSEWOYKN-FVGYRXGTSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)propanamide;hydrochloride |
| InChIKey | WOBDANBSEWOYKN-FVGYRXGTSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)