cas: 866028-26-4 — see every product listed under this CAS number, including other names
INF39, 99.86% (CAS 866028-26-4) is a chemical reagent available from Chemat. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-101868-10 mg |
| cas | 866028-26-4 |
| size | 10 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 mg | 969.85 Pln | |
| MedChemExpress | 25 mg | 1824.35 Pln | |
| MedChemExpress | 5 mg | 677.28 Pln | |
| MedChemExpress | 50 mg | 2678.84 Pln | |
| MedChemExpress | 100 mg | 3955.94 Pln | |
| MedChemExpress | 10mM/1mL | 728.36 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.86% |
Ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate (CAS 866028-26-4) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate. InChIKey: VTAOWWAFBSFWSG-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate |
| InChIKey | VTAOWWAFBSFWSG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C)CC1=CC=CC=C1Cl |
Computed by PubChem (NCBI)