Isopropyl 3-amino-4-chlorobenzoate, 97%
cas: 343773-02-4 — see every product listed under this CAS number, including other names
Isopropyl 3-amino-4-chlorobenzoate, 97% (CAS 343773-02-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg. Offered by: AmBeed, BLDpharm, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A436651-10g |
| cas | 343773-02-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 3962.98 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 865.44 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 292.14 Pln | |
| BLDpharm | 5g | 925.25 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 976.40 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 883.04 Pln | |
| Fluorochem | 10g | 1674.43 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Propan-2-yl 3-amino-4-chlorobenzoate (CAS 343773-02-4) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: propan-2-yl 3-amino-4-chlorobenzoate. InChIKey: MODGZMKPTCPKSN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | propan-2-yl 3-amino-4-chlorobenzoate |
| InChIKey | MODGZMKPTCPKSN-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(C=C1)Cl)N |
Computed by PubChem (NCBI)