Products 343773-02-4
CAS 343773-02-4 appears in our catalog under these names: Isopropyl 3-amino-4-chlorobenzoate, Isopropyl 3-amino-4-chlorobenzoate, 95%, Isopropyl 3-amino-4-chlorobenzoate, 97%, Isopropyl 3-amino-4-chlorobenzoate 97%, Isopropyl 3-amino-4-chlorobenzoate, 97%, 97%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Propan-2-yl 3-amino-4-chlorobenzoate (CAS 343773-02-4) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: propan-2-yl 3-amino-4-chlorobenzoate. InChIKey: MODGZMKPTCPKSN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | propan-2-yl 3-amino-4-chlorobenzoate |
| InChIKey | MODGZMKPTCPKSN-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(C=C1)Cl)N |
Computed by PubChem (NCBI)