cas: 2307-69-9 — see every product listed under this CAS number, including other names
Isopropyl 4-methylbenzenesulfonate, 95% (CAS 2307-69-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210874-1G |
| cas | 2307-69-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 549.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Propan-2-yl 4-methylbenzenesulfonate (CAS 2307-69-9) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: propan-2-yl 4-methylbenzenesulfonate. InChIKey: SDQCGKJCBWXRMK-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | propan-2-yl 4-methylbenzenesulfonate |
| InChIKey | SDQCGKJCBWXRMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC(C)C |
Computed by PubChem (NCBI)