cas: 924271-40-9 — see every product listed under this CAS number, including other names
Isoquinoline, 7-bromo-1,3-dichloro-, 97%, 97% (CAS 924271-40-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSEX-100mg |
| cas | 924271-40-9 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 717.20 Pln | |
| Chemat | 10g | 1173.20 Pln | |
| Chemat | 25g | 2450.00 Pln | |
| Chemat | 100g | 9611.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1,3-dichloroisoquinoline (CAS 924271-40-9) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-1,3-dichloroisoquinoline. InChIKey: DVPABFNTLVFBQI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-1,3-dichloroisoquinoline |
| InChIKey | DVPABFNTLVFBQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(N=C(C=C21)Cl)Cl)Br |
Computed by PubChem (NCBI)