CAS 315702-75-1 appears in our catalog under these names: KCC 07, KCC-07/ 99.93% (existing batch purity), KCC 07, KCC-07 99%, KCC 07, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 2mg, 5mg, 25mg, 100mg, 200mg, 250mg.
3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenol (CAS 315702-75-1) is a chemical compound with the molecular formula C14H11N3OS and a molecular weight of 269.32 g/mol. IUPAC name: 3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenol. InChIKey: GIGNWEDIMLUWCT-UHFFFAOYSA-N.
| Molecular formula | C14H11N3OS |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenol |
| InChIKey | GIGNWEDIMLUWCT-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)NC3=CC(=CC=C3)O |
Computed by PubChem (NCBI)