CAS 79220-94-3 appears in our catalog under these names: KRM-III/ 99.25% (existing batch purity), KRM–III, 1,4-Diphenyl-2,3-dihydro-1H-imidazole-2-thione, KRM-III, KRM-III, 98.08%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
3,5-diphenyl-1H-imidazole-2-thione (CAS 79220-94-3) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: 3,5-diphenyl-1H-imidazole-2-thione. InChIKey: QKOAQVKXZJFMET-UHFFFAOYSA-N.
| Molecular formula | C15H12N2S |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 3,5-diphenyl-1H-imidazole-2-thione |
| InChIKey | QKOAQVKXZJFMET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(C(=S)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)