cas: 1676-73-9 — see every product listed under this CAS number, including other names
L-Glutamic acid, 5-(phenylmethyl) ester, 98% (CAS 1676-73-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112XHS-1g |
| cas | 1676-73-9 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 122.00 Pln | |
| Chemat | 500g | 379.20 Pln | |
| Chemat | 1kg | 664.40 Pln | |
| Chemat | 5kg | 3048.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid (CAS 1676-73-9) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: BGGHCRNCRWQABU-JTQLQIEISA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | BGGHCRNCRWQABU-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)