cas: 13518-40-6 — see every product listed under this CAS number, including other names
L-Valine tert-butyl Ester Hydrochloride, 97%, 97% (CAS 13518-40-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114657-1g |
| cas | 13518-40-6 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 285.20 Pln | |
| Chemat | 500g | 1238.40 Pln | |
| Chemat | 1kg | 2387.60 Pln | |
| Chemat | 5kg | 7848.00 Pln | |
| Chemat | 10kg | price on request |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride (CAS 13518-40-6) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride. InChIKey: AUIVQIHTTVPKFS-FJXQXJEOSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride |
| InChIKey | AUIVQIHTTVPKFS-FJXQXJEOSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)