cas: 13518-40-6 — see every product listed under this CAS number, including other names
H-Val-OtBu.HCl, 97% (CAS 13518-40-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03138-1G |
| cas | 13518-40-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 341.56 Pln | |
| Fluorochem | 500g | 1445.34 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride (CAS 13518-40-6) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride. InChIKey: AUIVQIHTTVPKFS-FJXQXJEOSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-methylbutanoate;hydrochloride |
| InChIKey | AUIVQIHTTVPKFS-FJXQXJEOSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)