cas: 554-35-8 — see every product listed under this CAS number, including other names
Linamarin (CAS 554-35-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 250mg, 50mg, 100mg, 1000mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC40659-1 |
| cas | 554-35-8 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 615.76 Pln | |
| GLPBio | 10mg | 1116.58 Pln | |
| GLPBio | 25mg | 1916.94 Pln | |
| GLPBio | 5mg | 821.70 Pln | |
| Biosynth | 250mg | price on request | |
| Biosynth | 50mg | price on request | |
| Chemat | 100mg | 4035.17 Pln | |
| Chemat | 250mg | 7787.11 Pln | |
| Chemat | 25mg | 1601.36 Pln | |
| Chemat | 50mg | 2463.34 Pln | |
| Biosynth | 1000mg | price on request |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Linamarin is a beta-D-glucoside. It is functionally related to a 2-hydroxy-2-methylpropanenitrile.
Source: ChEBI
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | 2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanenitrile |
| InChIKey | QLTCHMYAEJEXBT-ZEBDFXRSSA-N |
| SMILES | CC(C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)