Products 1408064-40-3
CAS 1408064-40-3 appears in our catalog under these names: Methyl (S)-2-Amino-2-(3-nitrophenyl)acetate Hydrochloride, ≥95%, ≥95%, METHYL (S)-2-AMINO-2-(3-NITROPHENYL)ACETATE HCL, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Methyl (2S)-2-amino-2-(3-nitrophenyl)acetate;hydrochloride (CAS 1408064-40-3) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: methyl (2S)-2-amino-2-(3-nitrophenyl)acetate;hydrochloride. InChIKey: IVAIWWDGATYXNS-QRPNPIFTSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(3-nitrophenyl)acetate;hydrochloride |
| InChIKey | IVAIWWDGATYXNS-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC(=CC=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)