Products 131980-25-1
CAS 131980-25-1 is the registry number for 3-Nitrophenylalanine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-amino-3-(3-nitrophenyl)propanoic acid;hydrochloride (CAS 131980-25-1) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: 2-amino-3-(3-nitrophenyl)propanoic acid;hydrochloride. InChIKey: CEBCXIZYRLCPAE-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | 2-amino-3-(3-nitrophenyl)propanoic acid;hydrochloride |
| InChIKey | CEBCXIZYRLCPAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-nitrophenylalanine hydrochloride, 2-amino-3-(3-nitrophenyl)propanoic acid;hydrochloride, 3-Nitrophenylalanine HCl, 3-Nitro-DL-phenylalanine hydrochloride, 3-Nitrophenylalanine hydrochloride, DL-, Phenylalanine, 3-nitro-, monohydrochloride, DL-Phenylalanine, 3-nitro-, monohydrochloride, 2-Amino-3-(3-nitrophenyl)propanoic acid hydrochloride