CAS 147065-06-3 appears in our catalog under these names: H-D-Phe(4-NO2)-OH.HCl, 97%, H–D–Phe(4–NO2)–OH·HCl. Offered by: AmBeed, GLPBio. Available pack sizes: 5g.
(2R)-2-amino-3-(4-nitrophenyl)propanoic acid;hydrochloride (CAS 147065-06-3) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: (2R)-2-amino-3-(4-nitrophenyl)propanoic acid;hydrochloride. InChIKey: XNPWOQZTJFYSEI-DDWIOCJRSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-nitrophenyl)propanoic acid;hydrochloride |
| InChIKey | XNPWOQZTJFYSEI-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)