Products 170157-53-6
CAS 170157-53-6 is the registry number for (2R)-2-Amino-3-(3-nitrophenyl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(2R)-2-amino-3-(3-nitrophenyl)propanoic acid;hydrochloride (CAS 170157-53-6) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: (2R)-2-amino-3-(3-nitrophenyl)propanoic acid;hydrochloride. InChIKey: CEBCXIZYRLCPAE-DDWIOCJRSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-nitrophenyl)propanoic acid;hydrochloride |
| InChIKey | CEBCXIZYRLCPAE-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)