Products 647830-73-7
CAS 647830-73-7 is the registry number for 2-(4-Amino-2-hydroxybenzamido)acetic Acid Hydrochloride. Offered by: TRC. Available pack sizes: 750mg.
2-[(4-amino-2-hydroxybenzoyl)amino]acetic acid;hydrochloride (CAS 647830-73-7) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: 2-[(4-amino-2-hydroxybenzoyl)amino]acetic acid;hydrochloride. InChIKey: LKNHGIWKJBRBJQ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | 2-[(4-amino-2-hydroxybenzoyl)amino]acetic acid;hydrochloride |
| InChIKey | LKNHGIWKJBRBJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)O)C(=O)NCC(=O)O.Cl |
Computed by PubChem (NCBI)