Products 488797-44-0
CAS 488797-44-0 is the registry number for 1-Dehydro-2-dedichloroacetyl-chloramphenicol Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
(2R)-2-amino-3-hydroxy-1-(4-nitrophenyl)propan-1-one;hydrochloride (CAS 488797-44-0) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: (2R)-2-amino-3-hydroxy-1-(4-nitrophenyl)propan-1-one;hydrochloride. InChIKey: DOJXLFVVEIEJSX-DDWIOCJRSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | (2R)-2-amino-3-hydroxy-1-(4-nitrophenyl)propan-1-one;hydrochloride |
| InChIKey | DOJXLFVVEIEJSX-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C(=O)[C@@H](CO)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)