CAS 1281690-83-2 appears in our catalog under these names: 3-([Hydroxy(3-oxo-2,3-dihydropyridin-2-ylidene)methyl]amino)propanoic acid hydrochloride, 95%, 3-{(hydroxy(3-oxo-2,3-dihydropyridin-2-ylidene)methyl)amino}propanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-[(3-hydroxypyridine-2-carbonyl)amino]propanoic acid;hydrochloride (CAS 1281690-83-2) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: 3-[(3-hydroxypyridine-2-carbonyl)amino]propanoic acid;hydrochloride. InChIKey: QSBGUKCYTMMYGU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | 3-[(3-hydroxypyridine-2-carbonyl)amino]propanoic acid;hydrochloride |
| InChIKey | QSBGUKCYTMMYGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)NCCC(=O)O)O.Cl |
Computed by PubChem (NCBI)