Products 1382786-13-1

CAS 1382786-13-1 is the registry number for Diethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Diethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate (CAS 1382786-13-1) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: diethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate. InChIKey: YXEXOFBUDQKVMA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClN2O4
Molecular weight246.65 g/mol
IUPAC namediethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate
InChIKeyYXEXOFBUDQKVMA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=NN1)C(=O)OCC)Cl

Computed by PubChem (NCBI)