CAS 1382786-13-1 is the registry number for Diethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate (CAS 1382786-13-1) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: diethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate. InChIKey: YXEXOFBUDQKVMA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | diethyl 4-chloro-1H-pyrazole-3,5-dicarboxylate |
| InChIKey | YXEXOFBUDQKVMA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NN1)C(=O)OCC)Cl |
Computed by PubChem (NCBI)