cas: 750585-94-5 — see every product listed under this CAS number, including other names
METHYL 2-BROMO-3-FORMYLBENZOATE, 98% (CAS 750585-94-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F815956-100MG |
| cas | 750585-94-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 872.63 Pln | |
| Fluorochem | 1g | 2189.87 Pln | |
| Fluorochem | 5g | 5417.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-bromo-3-formylbenzoate (CAS 750585-94-5) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 2-bromo-3-formylbenzoate. InChIKey: CNQNIZZOOUMRHI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 2-bromo-3-formylbenzoate |
| InChIKey | CNQNIZZOOUMRHI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1Br)C=O |
Computed by PubChem (NCBI)