cas: 1043418-95-6 — see every product listed under this CAS number, including other names
METHYL 2-BROMO-5-FORMYLBENZOATE, 97% (CAS 1043418-95-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538068-250MG |
| cas | 1043418-95-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 2340.86 Pln | |
| Fluorochem | 10g | 4626.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-bromo-5-formylbenzoate (CAS 1043418-95-6) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 2-bromo-5-formylbenzoate. InChIKey: XQOANPCORUKMQY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 2-bromo-5-formylbenzoate |
| InChIKey | XQOANPCORUKMQY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C=O)Br |
Computed by PubChem (NCBI)