cas: 84832-02-0 — see every product listed under this CAS number, including other names
METHYL 3-AMINO-2,6-DIFLUOROBENZOATE, 98% (CAS 84832-02-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306916-5G |
| cas | 84832-02-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 487.35 Pln | |
| Fluorochem | 50g | 924.69 Pln | |
| Fluorochem | 100g | 1533.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-2,6-difluorobenzoate (CAS 84832-02-0) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 3-amino-2,6-difluorobenzoate. InChIKey: IUXHGFLADBGDTR-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 3-amino-2,6-difluorobenzoate |
| InChIKey | IUXHGFLADBGDTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)N)F |
Computed by PubChem (NCBI)