MSBN
cas: 135980-66-4 — see every product listed under this CAS number, including other names
MSBN (CAS 135980-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC74974-1 |
| cas | 135980-66-4 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 540.87 Pln | |
| GLPBio | 10mg | 915.31 Pln | |
| GLPBio | 100mg | 2207.13 Pln | |
| GLPBio | 25mg | 1252.31 Pln | |
| GLPBio | 5mg | 728.09 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 643.84 Pln | |
| GLPBio | 50mg | 1673.55 Pln | |
| Chemat | 1mg | 165.20 Pln | |
| Chemat | 200mg | 2334.80 Pln | |
| Chemat | 2mg | 150.80 Pln | |
| Chemat | 5mg | 227.60 Pln | |
| Chemat | 10mg | 328.40 Pln | |
| Chemat | 25mg | 510.80 Pln | |
| Chemat | 50mg | 741.20 Pln | |
| Chemat | 100mg | 1029.20 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-butyl-6-methylsulfonylbenzo[de]isoquinoline-1,3-dione (CAS 135980-66-4) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: 2-butyl-6-methylsulfonylbenzo[de]isoquinoline-1,3-dione. InChIKey: XJWPRGLACNOMLF-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 2-butyl-6-methylsulfonylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | XJWPRGLACNOMLF-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C3C(=C(C=C2)S(=O)(=O)C)C=CC=C3C1=O |
Computed by PubChem (NCBI)